About 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene
4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene (PubChem CID 54070444) has the molecular formula C9H12S
and a molecular weight of 152.26 g/mol. Its IUPAC name is 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene.
Analyze 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene?
The IUPAC name of 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene (CID 54070444) is 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene.
What is the SMILES notation for 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene?
The canonical SMILES for 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene is CC1=CC=CC2SCCC12.
What is the InChIKey of 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene?
The InChIKey is RKUZIQUXRUZYSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12S/c1-7-3-2-4-9-8(7)5-6-10-9/h2-4,8-9H,5-6H2,1H3.
What are the key properties of 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene?
4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene has a molecular weight of 152.26 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3,3a,7a-tetrahydro-1-benzothiophene is sourced from PubChem (CID 54070444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).