C8H6N4OS — CID 54070733
7-sulfanylidene-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),10-trien-5-one (PubChem CID 54070733) has the molecular formula C8H6N4OS and a molecular weight of 206.23 g/mol. Its IUPAC name is 7-sulfanylidene-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),10-trien-5-one.
| Compound Name | 7-sulfanylidene-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),10-trien-5-one |
|---|---|
| PubChem CID | 54070733 |
| Molecular Formula | C8H6N4OS |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 7-sulfanylidene-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),10-trien-5-one |
| SMILES | O=c1[nH]c(=S)n2c3c1cnn3C=CC2 |
| InChI | InChI=1S/C8H6N4OS/c13-6-5-4-9-12-3-1-2-11(7(5)12)8(14)10-6/h1,3-4H,2H2,(H,10,13,14) |
| InChIKey | MGGBVIVNJXJOOF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|