C14H24O — CID 54070810
3-but-1-enyl-4,4,6a-trimethyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan (PubChem CID 54070810) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 3-but-1-enyl-4,4,6a-trimethyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan.
| Compound Name | 3-but-1-enyl-4,4,6a-trimethyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan |
|---|---|
| PubChem CID | 54070810 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 3-but-1-enyl-4,4,6a-trimethyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan |
| SMILES | CCC=CC1OCC2(C)CCC(C)(C)C12 |
| InChI | InChI=1S/C14H24O/c1-5-6-7-11-12-13(2,3)8-9-14(12,4)10-15-11/h6-7,11-12H,5,8-10H2,1-4H3 |
| InChIKey | MGHNRDOIRSAFPL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|