About 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid
6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid (PubChem CID 54070992) has the molecular formula C12H18N4O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid |
| PubChem CID | 54070992 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid |
| SMILES | CCCCc1ccc(C(N)=NNC)c(C(=O)O)n1 |
| InChI | InChI=1S/C12H18N4O2/c1-3-4-5-8-6-7-9(11(13)16-14-2)10(15-8)12(17)18/h6-7,14H,3-5H2,1-2H3,(H2,13,16)(H,17,18) |
| InChIKey | MGKUDOUOZLQLQL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid?
The IUPAC name of 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid (CID 54070992) is 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid?
The canonical SMILES for 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid is CCCCc1ccc(C(N)=NNC)c(C(=O)O)n1.
What is the InChIKey of 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid?
The InChIKey is MGKUDOUOZLQLQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2/c1-3-4-5-8-6-7-9(11(13)16-14-2)10(15-8)12(17)18/h6-7,14H,3-5H2,1-2H3,(H2,13,16)(H,17,18).
What are the key properties of 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid?
6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid has a molecular weight of 250.30 g/mol, XLogP of 0.96, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-3-[N'-(methylamino)carbamimidoyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 54070992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).