About 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole
5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole (PubChem CID 54071113) has the molecular formula C8H5BrCl2O2
and a molecular weight of 283.94 g/mol. Its IUPAC name is 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole |
| PubChem CID | 54071113 |
| Molecular Formula | C8H5BrCl2O2 |
| Molecular Weight | 283.94 g/mol |
| Exact Mass | 281.88 |
| IUPAC Name | 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole |
| SMILES | Cc1cc2c(cc1Br)OC(Cl)(Cl)O2 |
| InChI | InChI=1S/C8H5BrCl2O2/c1-4-2-6-7(3-5(4)9)13-8(10,11)12-6/h2-3H,1H3 |
| InChIKey | MGMYGRBPUXOHGK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole?
The IUPAC name of 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole (CID 54071113) is 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole.
What is the SMILES notation for 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole?
The canonical SMILES for 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole is Cc1cc2c(cc1Br)OC(Cl)(Cl)O2.
What is the InChIKey of 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole?
The InChIKey is MGMYGRBPUXOHGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrCl2O2/c1-4-2-6-7(3-5(4)9)13-8(10,11)12-6/h2-3H,1H3.
What are the key properties of 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole?
5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole has a molecular weight of 283.94 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,2-dichloro-6-methyl-1,3-benzodioxole is sourced from PubChem (CID 54071113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).