About 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol
2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol (PubChem CID 54071158) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol.
Molecular Properties
| Compound Name | 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol |
| PubChem CID | 54071158 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol |
| SMILES | C/C=C(\C)COOCC(O)CC.CCC1CO1 |
| InChI | InChI=1S/C9H18O3.C4H8O/c1-4-8(3)6-11-12-7-9(10)5-2;1-2-4-3-5-4/h4,9-10H,5-7H2,1-3H3;4H,2-3H2,1H3/b8-4+; |
| InChIKey | MGNVSRQBGTYMTJ-ZFXMFRGYSA-N |
| XLogP | 2.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol?
The IUPAC name of 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol (CID 54071158) is 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol.
What is the SMILES notation for 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol?
The canonical SMILES for 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol is C/C=C(\C)COOCC(O)CC.CCC1CO1.
What is the InChIKey of 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol?
The InChIKey is MGNVSRQBGTYMTJ-ZFXMFRGYSA-N. The full InChI is InChI=1S/C9H18O3.C4H8O/c1-4-8(3)6-11-12-7-9(10)5-2;1-2-4-3-5-4/h4,9-10H,5-7H2,1-3H3;4H,2-3H2,1H3/b8-4+;.
What are the key properties of 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol?
2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol has a molecular weight of 246.35 g/mol, XLogP of 2.47, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyloxirane;1-[(E)-2-methylbut-2-enyl]peroxybutan-2-ol is sourced from PubChem (CID 54071158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).