C19H31NO6 — CID 54071273
2-[2,2,6,6-tetramethyl-4-(3-oxobutanoyloxy)piperidin-1-yl]ethyl 3-oxobutanoate (PubChem CID 54071273) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-[2,2,6,6-tetramethyl-4-(3-oxobutanoyloxy)piperidin-1-yl]ethyl 3-oxobutanoate.
| Compound Name | 2-[2,2,6,6-tetramethyl-4-(3-oxobutanoyloxy)piperidin-1-yl]ethyl 3-oxobutanoate |
|---|---|
| PubChem CID | 54071273 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-[2,2,6,6-tetramethyl-4-(3-oxobutanoyloxy)piperidin-1-yl]ethyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCN1C(C)(C)CC(OC(=O)CC(C)=O)CC1(C)C |
| InChI | InChI=1S/C19H31NO6/c1-13(21)9-16(23)25-8-7-20-18(3,4)11-15(12-19(20,5)6)26-17(24)10-14(2)22/h15H,7-12H2,1-6H3 |
| InChIKey | MGPUOEZUMZRPIT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|