About 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine
3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine (PubChem CID 54071493) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine.
Molecular Properties
| Compound Name | 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine |
| PubChem CID | 54071493 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine |
| SMILES | CN(C)C=CC=C1C=CC=C1 |
| InChI | InChI=1S/C10H13N/c1-11(2)9-5-8-10-6-3-4-7-10/h3-9H,1-2H3 |
| InChIKey | MGTPRVHSQCUPLG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine?
The IUPAC name of 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine (CID 54071493) is 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine.
What is the SMILES notation for 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine?
The canonical SMILES for 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine is CN(C)C=CC=C1C=CC=C1.
What is the InChIKey of 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine?
The InChIKey is MGTPRVHSQCUPLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-11(2)9-5-8-10-6-3-4-7-10/h3-9H,1-2H3.
What are the key properties of 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine?
3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine has a molecular weight of 147.22 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylprop-1-en-1-amine is sourced from PubChem (CID 54071493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).