About methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate
methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate (PubChem CID 54072040) has the molecular formula C15H16FNO2
and a molecular weight of 261.30 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate |
| PubChem CID | 54072040 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FNO2/c1-9-8-13(11-4-6-12(16)7-5-11)14(10(2)17-9)15(18)19-3/h4-7,13H,8H2,1-3H3 |
| InChIKey | MHCVMFVZMLNSSU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate?
The IUPAC name of methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate (CID 54072040) is methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate.
What is the SMILES notation for methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate?
The canonical SMILES for methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate is COC(=O)C1=C(C)N=C(C)CC1c1ccc(F)cc1.
What is the InChIKey of methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate?
The InChIKey is MHCVMFVZMLNSSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FNO2/c1-9-8-13(11-4-6-12(16)7-5-11)14(10(2)17-9)15(18)19-3/h4-7,13H,8H2,1-3H3.
What are the key properties of methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate?
methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate has a molecular weight of 261.30 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-fluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate is sourced from PubChem (CID 54072040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).