About 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione
1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione (PubChem CID 54072145) has the molecular formula C13H10Cl2N2O3
and a molecular weight of 313.14 g/mol. Its IUPAC name is 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione |
| PubChem CID | 54072145 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione |
| SMILES | CC(=O)N1CC(=O)NC(=Cc2c(Cl)cccc2Cl)C1=O |
| InChI | InChI=1S/C13H10Cl2N2O3/c1-7(18)17-6-12(19)16-11(13(17)20)5-8-9(14)3-2-4-10(8)15/h2-5H,6H2,1H3,(H,16,19) |
| InChIKey | MHEKABIHDCKUFP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione?
The IUPAC name of 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione (CID 54072145) is 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione.
What is the SMILES notation for 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione?
The canonical SMILES for 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione is CC(=O)N1CC(=O)NC(=Cc2c(Cl)cccc2Cl)C1=O.
What is the InChIKey of 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione?
The InChIKey is MHEKABIHDCKUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O3/c1-7(18)17-6-12(19)16-11(13(17)20)5-8-9(14)3-2-4-10(8)15/h2-5H,6H2,1H3,(H,16,19).
What are the key properties of 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione?
1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione has a molecular weight of 313.14 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-3-[(2,6-dichlorophenyl)methylidene]piperazine-2,5-dione is sourced from PubChem (CID 54072145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).