About 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime
3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime (PubChem CID 5407249) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is (NZ)-N-(3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime |
| PubChem CID | 5407249 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (NZ)-N-(3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine |
| SMILES | CCCC1=NOC2=C1/C(=N\O)/CCC2 |
| InChI | InChI=1S/C10H14N2O2/c1-2-4-8-10-7(11-13)5-3-6-9(10)14-12-8/h13H,2-6H2,1H3/b11-7- |
| InChIKey | VHGZNFIFFJMVTP-XFFZJAGNSA-N |
| XLogP | 2.00 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 230 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime?
The IUPAC name of 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime (CID 5407249) is (NZ)-N-(3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine.
What is the SMILES notation for 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime?
The canonical SMILES for 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime is CCCC1=NOC2=C1/C(=N\O)/CCC2.
What is the InChIKey of 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime?
The InChIKey is VHGZNFIFFJMVTP-XFFZJAGNSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-2-4-8-10-7(11-13)5-3-6-9(10)14-12-8/h13H,2-6H2,1H3/b11-7-.
What are the key properties of 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime?
3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime has a molecular weight of 194.23 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Propyl-6,7-dihydro-5H-benzo[d]isoxazol-4-one oxime is sourced from PubChem (CID 5407249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).