About 3-thiophen-3-yl-1,2,4-benzotriazine
3-thiophen-3-yl-1,2,4-benzotriazine (PubChem CID 54072870) has the molecular formula C11H7N3S
and a molecular weight of 213.27 g/mol. Its IUPAC name is 3-thiophen-3-yl-1,2,4-benzotriazine.
Molecular Properties
| Compound Name | 3-thiophen-3-yl-1,2,4-benzotriazine |
| PubChem CID | 54072870 |
| Molecular Formula | C11H7N3S |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 3-thiophen-3-yl-1,2,4-benzotriazine |
| SMILES | c1ccc2nc(-c3ccsc3)nnc2c1 |
| InChI | InChI=1S/C11H7N3S/c1-2-4-10-9(3-1)12-11(14-13-10)8-5-6-15-7-8/h1-7H |
| InChIKey | ASUBPYFTHOPMNW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-thiophen-3-yl-1,2,4-benzotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-3-yl-1,2,4-benzotriazine?
The IUPAC name of 3-thiophen-3-yl-1,2,4-benzotriazine (CID 54072870) is 3-thiophen-3-yl-1,2,4-benzotriazine.
What is the SMILES notation for 3-thiophen-3-yl-1,2,4-benzotriazine?
The canonical SMILES for 3-thiophen-3-yl-1,2,4-benzotriazine is c1ccc2nc(-c3ccsc3)nnc2c1.
What is the InChIKey of 3-thiophen-3-yl-1,2,4-benzotriazine?
The InChIKey is ASUBPYFTHOPMNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3S/c1-2-4-10-9(3-1)12-11(14-13-10)8-5-6-15-7-8/h1-7H.
What are the key properties of 3-thiophen-3-yl-1,2,4-benzotriazine?
3-thiophen-3-yl-1,2,4-benzotriazine has a molecular weight of 213.27 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-3-yl-1,2,4-benzotriazine is sourced from PubChem (CID 54072870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).