C26H36O3S — CID 54072901
3,5-dibenzyl-3-(hydroxymethyl)-5-(1-hydroxy-4-methylpentyl)thian-4-ol (PubChem CID 54072901) has the molecular formula C26H36O3S and a molecular weight of 428.64 g/mol. Its IUPAC name is 3,5-dibenzyl-3-(hydroxymethyl)-5-(1-hydroxy-4-methylpentyl)thian-4-ol.
| Compound Name | 3,5-dibenzyl-3-(hydroxymethyl)-5-(1-hydroxy-4-methylpentyl)thian-4-ol |
|---|---|
| PubChem CID | 54072901 |
| Molecular Formula | C26H36O3S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 3,5-dibenzyl-3-(hydroxymethyl)-5-(1-hydroxy-4-methylpentyl)thian-4-ol |
| SMILES | CC(C)CCC(O)C1(Cc2ccccc2)CSCC(CO)(Cc2ccccc2)C1O |
| InChI | InChI=1S/C26H36O3S/c1-20(2)13-14-23(28)26(16-22-11-7-4-8-12-22)19-30-18-25(17-27,24(26)29)15-21-9-5-3-6-10-21/h3-12,20,23-24,27-29H,13-19H2,1-2H3 |
| InChIKey | MHSMYVYMJNONRJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |