About N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide
N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide (PubChem CID 54072951) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide |
| PubChem CID | 54072951 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide |
| SMILES | CCCCNC(=O)C1=CC=C(C)C1 |
| InChI | InChI=1S/C11H17NO/c1-3-4-7-12-11(13)10-6-5-9(2)8-10/h5-6H,3-4,7-8H2,1-2H3,(H,12,13) |
| InChIKey | MHTFPFLOYLHYBZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide?
The IUPAC name of N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide (CID 54072951) is N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide.
What is the SMILES notation for N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide?
The canonical SMILES for N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide is CCCCNC(=O)C1=CC=C(C)C1.
What is the InChIKey of N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide?
The InChIKey is MHTFPFLOYLHYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-3-4-7-12-11(13)10-6-5-9(2)8-10/h5-6H,3-4,7-8H2,1-2H3,(H,12,13).
What are the key properties of N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide?
N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide has a molecular weight of 179.26 g/mol, XLogP of 2.18, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-methylcyclopenta-1,3-diene-1-carboxamide is sourced from PubChem (CID 54072951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).