C19H30O3 — CID 54073219
6-hydroxy-6-methyl-8-(2,5,6,6-tetramethylcyclohexen-1-yl)oct-4-ynoic acid (PubChem CID 54073219) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 6-hydroxy-6-methyl-8-(2,5,6,6-tetramethylcyclohexen-1-yl)oct-4-ynoic acid.
| Compound Name | 6-hydroxy-6-methyl-8-(2,5,6,6-tetramethylcyclohexen-1-yl)oct-4-ynoic acid |
|---|---|
| PubChem CID | 54073219 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 6-hydroxy-6-methyl-8-(2,5,6,6-tetramethylcyclohexen-1-yl)oct-4-ynoic acid |
| SMILES | CC1=C(CCC(C)(O)C#CCCC(=O)O)C(C)(C)C(C)CC1 |
| InChI | InChI=1S/C19H30O3/c1-14-9-10-15(2)18(3,4)16(14)11-13-19(5,22)12-7-6-8-17(20)21/h15,22H,6,8-11,13H2,1-5H3,(H,20,21) |
| InChIKey | MHXSBSCSMISHGI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|