About 2-phenylethylcyclooctane
2-phenylethylcyclooctane (PubChem CID 54073487) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-phenylethylcyclooctane.
Molecular Properties
| Compound Name | 2-phenylethylcyclooctane |
| PubChem CID | 54073487 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-phenylethylcyclooctane |
| SMILES | c1ccc(CCC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C16H24/c1-2-5-9-15(10-6-3-1)13-14-16-11-7-4-8-12-16/h4,7-8,11-12,15H,1-3,5-6,9-10,13-14H2 |
| InChIKey | DJYZFPDWCSFZSW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-phenylethylcyclooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethylcyclooctane?
The IUPAC name of 2-phenylethylcyclooctane (CID 54073487) is 2-phenylethylcyclooctane.
What is the SMILES notation for 2-phenylethylcyclooctane?
The canonical SMILES for 2-phenylethylcyclooctane is c1ccc(CCC2CCCCCCC2)cc1.
What is the InChIKey of 2-phenylethylcyclooctane?
The InChIKey is DJYZFPDWCSFZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24/c1-2-5-9-15(10-6-3-1)13-14-16-11-7-4-8-12-16/h4,7-8,11-12,15H,1-3,5-6,9-10,13-14H2.
What are the key properties of 2-phenylethylcyclooctane?
2-phenylethylcyclooctane has a molecular weight of 216.37 g/mol, XLogP of 4.98, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethylcyclooctane is sourced from PubChem (CID 54073487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).