About 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene
11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene (PubChem CID 54073519) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene.
Molecular Properties
| Compound Name | 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene |
| PubChem CID | 54073519 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene |
| SMILES | CC=CC(C)C1CC=CCCC=CCC(C)/C=N/1 |
| InChI | InChI=1S/C17H27N/c1-4-11-16(3)17-13-10-8-6-5-7-9-12-15(2)14-18-17/h4,7-11,14-17H,5-6,12-13H2,1-3H3/b9-7?,10-8?,11-4?,18-14+ |
| InChIKey | MICKYOBSRYQTBZ-MPNWTORKSA-N |
| XLogP | 4.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene?
The IUPAC name of 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene (CID 54073519) is 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene.
What is the SMILES notation for 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene?
The canonical SMILES for 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene is CC=CC(C)C1CC=CCCC=CCC(C)/C=N/1.
What is the InChIKey of 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene?
The InChIKey is MICKYOBSRYQTBZ-MPNWTORKSA-N. The full InChI is InChI=1S/C17H27N/c1-4-11-16(3)17-13-10-8-6-5-7-9-12-15(2)14-18-17/h4,7-11,14-17H,5-6,12-13H2,1-3H3/b9-7?,10-8?,11-4?,18-14+.
What are the key properties of 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene?
11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene has a molecular weight of 245.41 g/mol, XLogP of 4.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene is sourced from PubChem (CID 54073519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).