About 2-(4-aminoanilino)-1,1-dimethylguanidine
2-(4-aminoanilino)-1,1-dimethylguanidine (PubChem CID 54073540) has the molecular formula C9H15N5
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(4-aminoanilino)-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-(4-aminoanilino)-1,1-dimethylguanidine |
| PubChem CID | 54073540 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2-(4-aminoanilino)-1,1-dimethylguanidine |
| SMILES | CN(C)C(N)=NNc1ccc(N)cc1 |
| InChI | InChI=1S/C9H15N5/c1-14(2)9(11)13-12-8-5-3-7(10)4-6-8/h3-6,12H,10H2,1-2H3,(H2,11,13) |
| InChIKey | MICXMCLVQLYUCS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminoanilino)-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminoanilino)-1,1-dimethylguanidine?
The IUPAC name of 2-(4-aminoanilino)-1,1-dimethylguanidine (CID 54073540) is 2-(4-aminoanilino)-1,1-dimethylguanidine.
What is the SMILES notation for 2-(4-aminoanilino)-1,1-dimethylguanidine?
The canonical SMILES for 2-(4-aminoanilino)-1,1-dimethylguanidine is CN(C)C(N)=NNc1ccc(N)cc1.
What is the InChIKey of 2-(4-aminoanilino)-1,1-dimethylguanidine?
The InChIKey is MICXMCLVQLYUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5/c1-14(2)9(11)13-12-8-5-3-7(10)4-6-8/h3-6,12H,10H2,1-2H3,(H2,11,13).
What are the key properties of 2-(4-aminoanilino)-1,1-dimethylguanidine?
2-(4-aminoanilino)-1,1-dimethylguanidine has a molecular weight of 193.25 g/mol, XLogP of 0.47, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminoanilino)-1,1-dimethylguanidine is sourced from PubChem (CID 54073540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).