About N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide
N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide (PubChem CID 54073691) has the molecular formula C17H17F4N3O4
and a molecular weight of 403.33 g/mol. Its IUPAC name is N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide.
Molecular Properties
| Compound Name | N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide |
| PubChem CID | 54073691 |
| Molecular Formula | C17H17F4N3O4 |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide |
| SMILES | N#CC1(c2ccc(OC(F)F)c(OC(F)F)c2)CCC(NC(=O)C(N)=O)CC1 |
| InChI | InChI=1S/C17H17F4N3O4/c18-15(19)27-11-2-1-9(7-12(11)28-16(20)21)17(8-22)5-3-10(4-6-17)24-14(26)13(23)25/h1-2,7,10,15-16H,3-6H2,(H2,23,25)(H,24,26) |
| InChIKey | MIFUPWHTMHPMGW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide?
The IUPAC name of N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide (CID 54073691) is N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide.
What is the SMILES notation for N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide?
The canonical SMILES for N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide is N#CC1(c2ccc(OC(F)F)c(OC(F)F)c2)CCC(NC(=O)C(N)=O)CC1.
What is the InChIKey of N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide?
The InChIKey is MIFUPWHTMHPMGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F4N3O4/c18-15(19)27-11-2-1-9(7-12(11)28-16(20)21)17(8-22)5-3-10(4-6-17)24-14(26)13(23)25/h1-2,7,10,15-16H,3-6H2,(H2,23,25)(H,24,26).
What are the key properties of N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide?
N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide has a molecular weight of 403.33 g/mol, XLogP of 2.19, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]oxamide is sourced from PubChem (CID 54073691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).