About [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate
[3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate (PubChem CID 54073701) has the molecular formula C18H15F3N2O6S
and a molecular weight of 444.39 g/mol. Its IUPAC name is [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate |
| PubChem CID | 54073701 |
| Molecular Formula | C18H15F3N2O6S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(C=Cc2cc(C)c(C#N)c(=O)n2OS(=O)(=O)C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C18H15F3N2O6S/c1-11-8-13(6-4-12-5-7-14(27-2)9-16(12)28-3)23(17(24)15(11)10-22)29-30(25,26)18(19,20)21/h4-9H,1-3H3 |
| InChIKey | MIFYTHLXISAOQJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 107.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate?
The IUPAC name of [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate (CID 54073701) is [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate.
What is the SMILES notation for [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate?
The canonical SMILES for [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate is COc1ccc(C=Cc2cc(C)c(C#N)c(=O)n2OS(=O)(=O)C(F)(F)F)c(OC)c1.
What is the InChIKey of [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate?
The InChIKey is MIFYTHLXISAOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N2O6S/c1-11-8-13(6-4-12-5-7-14(27-2)9-16(12)28-3)23(17(24)15(11)10-22)29-30(25,26)18(19,20)21/h4-9H,1-3H3.
What are the key properties of [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate?
[3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate has a molecular weight of 444.39 g/mol, XLogP of 2.49, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-cyano-6-[2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate is sourced from PubChem (CID 54073701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).