C13H15N5O2 — CID 54073718
N'-[5-(2,6-dimethylphenyl)-4-oxo-1,3,5-triazin-2-yl]acetohydrazide (PubChem CID 54073718) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is N'-[5-(2,6-dimethylphenyl)-4-oxo-1,3,5-triazin-2-yl]acetohydrazide.
| Compound Name | N'-[5-(2,6-dimethylphenyl)-4-oxo-1,3,5-triazin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 54073718 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N'-[5-(2,6-dimethylphenyl)-4-oxo-1,3,5-triazin-2-yl]acetohydrazide |
| SMILES | CC(=O)NNc1ncn(-c2c(C)cccc2C)c(=O)n1 |
| InChI | InChI=1S/C13H15N5O2/c1-8-5-4-6-9(2)11(8)18-7-14-12(15-13(18)20)17-16-10(3)19/h4-7H,1-3H3,(H,16,19)(H,15,17,20) |
| InChIKey | MIGIAGBDYATSKF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|