About [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate
[4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate (PubChem CID 540740) has the molecular formula C16H19NO4
and a molecular weight of 289.33 g/mol. Its IUPAC name is [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate.
Molecular Properties
| Compound Name | [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate |
| PubChem CID | 540740 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C2=CCN(C(C)=O)CC2)ccc1OC(C)=O |
| InChI | InChI=1S/C16H19NO4/c1-11(18)17-8-6-13(7-9-17)14-4-5-15(21-12(2)19)16(10-14)20-3/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | DRYOTKMYLKQEEC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate?
The IUPAC name of [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate (CID 540740) is [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate.
What is the SMILES notation for [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate?
The canonical SMILES for [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate is COc1cc(C2=CCN(C(C)=O)CC2)ccc1OC(C)=O.
What is the InChIKey of [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate?
The InChIKey is DRYOTKMYLKQEEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4/c1-11(18)17-8-6-13(7-9-17)14-4-5-15(21-12(2)19)16(10-14)20-3/h4-6,10H,7-9H2,1-3H3.
What are the key properties of [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate?
[4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate has a molecular weight of 289.33 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] acetate is sourced from PubChem (CID 540740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).