About (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate
(2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate (PubChem CID 54074051) has the molecular formula C20H22O6
and a molecular weight of 358.39 g/mol. Its IUPAC name is (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate.
Molecular Properties
| Compound Name | (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate |
| PubChem CID | 54074051 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate |
| SMILES | Cc1ccccc1C(=O)OOOOC(=O)c1cccc(C(C)(C)C)c1C |
| InChI | InChI=1S/C20H22O6/c1-13-9-6-7-10-15(13)18(21)23-25-26-24-19(22)16-11-8-12-17(14(16)2)20(3,4)5/h6-12H,1-5H3 |
| InChIKey | MILPKWZQPUVEDE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate?
The IUPAC name of (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate (CID 54074051) is (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate.
What is the SMILES notation for (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate?
The canonical SMILES for (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate is Cc1ccccc1C(=O)OOOOC(=O)c1cccc(C(C)(C)C)c1C.
What is the InChIKey of (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate?
The InChIKey is MILPKWZQPUVEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O6/c1-13-9-6-7-10-15(13)18(21)23-25-26-24-19(22)16-11-8-12-17(14(16)2)20(3,4)5/h6-12H,1-5H3.
What are the key properties of (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate?
(2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate has a molecular weight of 358.39 g/mol, XLogP of 4.39, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylbenzoyl)peroxy 3-tert-butyl-2-methylbenzenecarboperoxoate is sourced from PubChem (CID 54074051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).