C22H32O4 — CID 54074409
[(1S)-1-(2,4b,7,10a-tetramethyl-1,8-dioxo-5,6,7,8a,9,10-hexahydro-4aH-phenanthren-2-yl)ethyl] acetate (PubChem CID 54074409) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(1S)-1-(2,4b,7,10a-tetramethyl-1,8-dioxo-5,6,7,8a,9,10-hexahydro-4aH-phenanthren-2-yl)ethyl] acetate.
| Compound Name | [(1S)-1-(2,4b,7,10a-tetramethyl-1,8-dioxo-5,6,7,8a,9,10-hexahydro-4aH-phenanthren-2-yl)ethyl] acetate |
|---|---|
| PubChem CID | 54074409 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1S)-1-(2,4b,7,10a-tetramethyl-1,8-dioxo-5,6,7,8a,9,10-hexahydro-4aH-phenanthren-2-yl)ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)C1(C)C=CC2C(C)(CCC3C(=O)C(C)CCC32C)C1=O |
| InChI | InChI=1S/C22H32O4/c1-13-7-10-21(5)16(18(13)24)8-11-22(6)17(21)9-12-20(4,19(22)25)14(2)26-15(3)23/h9,12-14,16-17H,7-8,10-11H2,1-6H3/t13?,14-,16?,17?,20?,21?,22?/m0/s1 |
| InChIKey | MIRGPGQHFJXAMR-OILOYNJMSA-N |
| XLogP | 4.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|