C15H14N2O3 — CID 5407507
3,5-dihydroxy-N-[(Z)-(3-methylphenyl)methylideneamino]benzamide (PubChem CID 5407507) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(Z)-(3-methylphenyl)methylideneamino]benzamide.
| Compound Name | 3,5-dihydroxy-N-[(Z)-(3-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5407507 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3,5-dihydroxy-N-[(Z)-(3-methylphenyl)methylideneamino]benzamide |
| SMILES | Cc1cccc(/C=N\NC(=O)c2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C15H14N2O3/c1-10-3-2-4-11(5-10)9-16-17-15(20)12-6-13(18)8-14(19)7-12/h2-9,18-19H,1H3,(H,17,20)/b16-9- |
| InChIKey | QXCDBTRUVBFFDM-SXGWCWSVSA-N |
| XLogP | 2.17 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|