About N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide
N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide (PubChem CID 54075118) has the molecular formula C21H28N2O3S
and a molecular weight of 388.53 g/mol. Its IUPAC name is N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide |
| PubChem CID | 54075118 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide |
| SMILES | CC(CCc1cccc(NS(C)(=O)=O)c1)NCC1CCOc2ccccc21 |
| InChI | InChI=1S/C21H28N2O3S/c1-16(10-11-17-6-5-7-19(14-17)23-27(2,24)25)22-15-18-12-13-26-21-9-4-3-8-20(18)21/h3-9,14,16,18,22-23H,10-13,15H2,1-2H3 |
| InChIKey | MJDMTMPXSQVUPL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide?
The IUPAC name of N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide (CID 54075118) is N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide is CC(CCc1cccc(NS(C)(=O)=O)c1)NCC1CCOc2ccccc21.
What is the InChIKey of N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide?
The InChIKey is MJDMTMPXSQVUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O3S/c1-16(10-11-17-6-5-7-19(14-17)23-27(2,24)25)22-15-18-12-13-26-21-9-4-3-8-20(18)21/h3-9,14,16,18,22-23H,10-13,15H2,1-2H3.
What are the key properties of N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide?
N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide has a molecular weight of 388.53 g/mol, XLogP of 3.54, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[3-(3,4-dihydro-2H-chromen-4-ylmethylamino)butyl]phenyl]methanesulfonamide is sourced from PubChem (CID 54075118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).