C26H44O5 — CID 54075316
methyl 7-[(1R,2S,5S)-2-acetyloxy-5-(9-methyldec-8-enyl)cyclopentyl]-2-oxoheptanoate (PubChem CID 54075316) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is methyl 7-[(1R,2S,5S)-2-acetyloxy-5-(9-methyldec-8-enyl)cyclopentyl]-2-oxoheptanoate.
| Compound Name | methyl 7-[(1R,2S,5S)-2-acetyloxy-5-(9-methyldec-8-enyl)cyclopentyl]-2-oxoheptanoate |
|---|---|
| PubChem CID | 54075316 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | methyl 7-[(1R,2S,5S)-2-acetyloxy-5-(9-methyldec-8-enyl)cyclopentyl]-2-oxoheptanoate |
| SMILES | COC(=O)C(=O)CCCCC[C@@H]1[C@@H](CCCCCCCC=C(C)C)CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H44O5/c1-20(2)14-10-7-5-6-8-11-15-22-18-19-25(31-21(3)27)23(22)16-12-9-13-17-24(28)26(29)30-4/h14,22-23,25H,5-13,15-19H2,1-4H3/t22-,23+,25-/m0/s1 |
| InChIKey | MJGQZODXXWVGGC-ARNLJNQMSA-N |
| XLogP | 6.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|