About (3S,4R)-3-fluoro-4,5-dihydroxypentanal
(3S,4R)-3-fluoro-4,5-dihydroxypentanal (PubChem CID 54075672) has the molecular formula C5H9FO3
and a molecular weight of 136.12 g/mol. Its IUPAC name is (3S,4R)-3-fluoro-4,5-dihydroxypentanal.
Molecular Properties
| Compound Name | (3S,4R)-3-fluoro-4,5-dihydroxypentanal |
| PubChem CID | 54075672 |
| Molecular Formula | C5H9FO3 |
| Molecular Weight | 136.12 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | (3S,4R)-3-fluoro-4,5-dihydroxypentanal |
| SMILES | O=CC[C@H](F)[C@H](O)CO |
| InChI | InChI=1S/C5H9FO3/c6-4(1-2-7)5(9)3-8/h2,4-5,8-9H,1,3H2/t4-,5+/m0/s1 |
| InChIKey | MJMJUKHABPJQGX-CRCLSJGQSA-N |
| XLogP | -0.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.12 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-3-fluoro-4,5-dihydroxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3-fluoro-4,5-dihydroxypentanal?
The IUPAC name of (3S,4R)-3-fluoro-4,5-dihydroxypentanal (CID 54075672) is (3S,4R)-3-fluoro-4,5-dihydroxypentanal.
What is the SMILES notation for (3S,4R)-3-fluoro-4,5-dihydroxypentanal?
The canonical SMILES for (3S,4R)-3-fluoro-4,5-dihydroxypentanal is O=CC[C@H](F)[C@H](O)CO.
What is the InChIKey of (3S,4R)-3-fluoro-4,5-dihydroxypentanal?
The InChIKey is MJMJUKHABPJQGX-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H9FO3/c6-4(1-2-7)5(9)3-8/h2,4-5,8-9H,1,3H2/t4-,5+/m0/s1.
What are the key properties of (3S,4R)-3-fluoro-4,5-dihydroxypentanal?
(3S,4R)-3-fluoro-4,5-dihydroxypentanal has a molecular weight of 136.12 g/mol, XLogP of -0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3-fluoro-4,5-dihydroxypentanal is sourced from PubChem (CID 54075672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).