About 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid
2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid (PubChem CID 54075788) has the molecular formula C35H46O4
and a molecular weight of 530.75 g/mol. Its IUPAC name is 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid |
| PubChem CID | 54075788 |
| Molecular Formula | C35H46O4 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid |
| SMILES | CC1CCC(C(C)C)C(c2ccc3c(=O)c4cccc(CC(=O)O)c4oc3c2C2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C35H46O4/c1-19(2)24-12-10-21(5)16-29(24)26-14-15-28-33(38)27-9-7-8-23(18-31(36)37)34(27)39-35(28)32(26)30-17-22(6)11-13-25(30)20(3)4/h7-9,14-15,19-22,24-25,29-30H,10-13,16-18H2,1-6H3,(H,36,37) |
| InChIKey | MJOOMKGFVXLLNK-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid?
The IUPAC name of 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid (CID 54075788) is 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid.
What is the SMILES notation for 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid?
The canonical SMILES for 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid is CC1CCC(C(C)C)C(c2ccc3c(=O)c4cccc(CC(=O)O)c4oc3c2C2CC(C)CCC2C(C)C)C1.
What is the InChIKey of 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid?
The InChIKey is MJOOMKGFVXLLNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H46O4/c1-19(2)24-12-10-21(5)16-29(24)26-14-15-28-33(38)27-9-7-8-23(18-31(36)37)34(27)39-35(28)32(26)30-17-22(6)11-13-25(30)20(3)4/h7-9,14-15,19-22,24-25,29-30H,10-13,16-18H2,1-6H3,(H,36,37).
What are the key properties of 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid?
2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid has a molecular weight of 530.75 g/mol, XLogP of 8.92, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,6-bis(5-methyl-2-propan-2-ylcyclohexyl)-9-oxoxanthen-4-yl]acetic acid is sourced from PubChem (CID 54075788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).