C16H20O2 — CID 54076048
4,4-dimethyl-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 54076048) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4,4-dimethyl-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 54076048 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 4,4-dimethyl-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(C)(C)C2=O)c(C)c1 |
| InChI | InChI=1S/C16H20O2/c1-9-6-10(2)13(11(3)7-9)14-12(17)8-16(4,5)15(14)18/h6-7,14H,8H2,1-5H3 |
| InChIKey | MJSXNOUTVCZQQP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|