C18H17F3N2O4 — CID 54076862
2-hydroxy-6-oxo-1-[3-(2-phenoxyethoxy)propyl]-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 54076862) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is 2-hydroxy-6-oxo-1-[3-(2-phenoxyethoxy)propyl]-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-hydroxy-6-oxo-1-[3-(2-phenoxyethoxy)propyl]-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 54076862 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-hydroxy-6-oxo-1-[3-(2-phenoxyethoxy)propyl]-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(C(F)(F)F)cc(=O)n(CCCOCCOc2ccccc2)c1O |
| InChI | InChI=1S/C18H17F3N2O4/c19-18(20,21)15-11-16(24)23(17(25)14(15)12-22)7-4-8-26-9-10-27-13-5-2-1-3-6-13/h1-3,5-6,11,25H,4,7-10H2 |
| InChIKey | ALROHVZAGAQKRE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|