C32H27F6N3O3 — CID 54077089
N-[4-[[(2R,4S)-1-[3,5-bis(trifluoromethyl)benzoyl]-4-(quinolin-4-ylmethoxy)piperidin-2-yl]methyl]phenyl]formamide (PubChem CID 54077089) has the molecular formula C32H27F6N3O3 and a molecular weight of 615.57 g/mol. Its IUPAC name is N-[4-[[(2R,4S)-1-[3,5-bis(trifluoromethyl)benzoyl]-4-(quinolin-4-ylmethoxy)piperidin-2-yl]methyl]phenyl]formamide.
| Compound Name | N-[4-[[(2R,4S)-1-[3,5-bis(trifluoromethyl)benzoyl]-4-(quinolin-4-ylmethoxy)piperidin-2-yl]methyl]phenyl]formamide |
|---|---|
| PubChem CID | 54077089 |
| Molecular Formula | C32H27F6N3O3 |
| Molecular Weight | 615.57 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | N-[4-[[(2R,4S)-1-[3,5-bis(trifluoromethyl)benzoyl]-4-(quinolin-4-ylmethoxy)piperidin-2-yl]methyl]phenyl]formamide |
| SMILES | O=CNc1ccc(C[C@@H]2C[C@@H](OCc3ccnc4ccccc34)CCN2C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C32H27F6N3O3/c33-31(34,35)23-14-22(15-24(16-23)32(36,37)38)30(43)41-12-10-27(17-26(41)13-20-5-7-25(8-6-20)40-19-42)44-18-21-9-11-39-29-4-2-1-3-28(21)29/h1-9,11,14-16,19,26-27H,10,12-13,17-18H2,(H,40,42)/t26-,27+/m1/s1 |
| InChIKey | MKLVJZFYKQKVNG-SXOMAYOGSA-N |
| XLogP | 7.27 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.57 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|