C22H38N2O3S — CID 54077466
N-cyclohexyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide (PubChem CID 54077466) has the molecular formula C22H38N2O3S and a molecular weight of 410.62 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide.
| Compound Name | N-cyclohexyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide |
|---|---|
| PubChem CID | 54077466 |
| Molecular Formula | C22H38N2O3S |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-cyclohexyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide |
| SMILES | CCCCCCCCCn1c(O)cc(SCCN(C=O)C2CCCCC2)c1O |
| InChI | InChI=1S/C22H38N2O3S/c1-2-3-4-5-6-7-11-14-24-21(26)17-20(22(24)27)28-16-15-23(18-25)19-12-9-8-10-13-19/h17-19,26-27H,2-16H2,1H3 |
| InChIKey | MKSJVRHJVNXDCL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|