About 1-undec-10-enylpyrrole-2,5-diol
1-undec-10-enylpyrrole-2,5-diol (PubChem CID 54078128) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-undec-10-enylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-undec-10-enylpyrrole-2,5-diol |
| PubChem CID | 54078128 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-undec-10-enylpyrrole-2,5-diol |
| SMILES | C=CCCCCCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C15H25NO2/c1-2-3-4-5-6-7-8-9-10-13-16-14(17)11-12-15(16)18/h2,11-12,17-18H,1,3-10,13H2 |
| InChIKey | MLDOBVUTKJFHKG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-undec-10-enylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-undec-10-enylpyrrole-2,5-diol?
The IUPAC name of 1-undec-10-enylpyrrole-2,5-diol (CID 54078128) is 1-undec-10-enylpyrrole-2,5-diol.
What is the SMILES notation for 1-undec-10-enylpyrrole-2,5-diol?
The canonical SMILES for 1-undec-10-enylpyrrole-2,5-diol is C=CCCCCCCCCCn1c(O)ccc1O.
What is the InChIKey of 1-undec-10-enylpyrrole-2,5-diol?
The InChIKey is MLDOBVUTKJFHKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2/c1-2-3-4-5-6-7-8-9-10-13-16-14(17)11-12-15(16)18/h2,11-12,17-18H,1,3-10,13H2.
What are the key properties of 1-undec-10-enylpyrrole-2,5-diol?
1-undec-10-enylpyrrole-2,5-diol has a molecular weight of 251.37 g/mol, XLogP of 4.21, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-undec-10-enylpyrrole-2,5-diol is sourced from PubChem (CID 54078128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).