C10H22BNO — CID 54078171
N-dimethyl-N-[[(1S,3R)-3-methylcyclohexyl]methyl]boronamidic acid (PubChem CID 54078171) has the molecular formula C10H22BNO and a molecular weight of 183.10 g/mol. Its IUPAC name is N-dimethyl-N-[[(1S,3R)-3-methylcyclohexyl]methyl]boronamidic acid.
| Compound Name | N-dimethyl-N-[[(1S,3R)-3-methylcyclohexyl]methyl]boronamidic acid |
|---|---|
| PubChem CID | 54078171 |
| Molecular Formula | C10H22BNO |
| Molecular Weight | 183.10 g/mol |
| Exact Mass | 183.18 |
| IUPAC Name | N-dimethyl-N-[[(1S,3R)-3-methylcyclohexyl]methyl]boronamidic acid |
| SMILES | CB(O)N(C)C[C@H]1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C10H22BNO/c1-9-5-4-6-10(7-9)8-12(3)11(2)13/h9-10,13H,4-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | MLEGECHASHLKEU-ZJUUUORDSA-N |
| XLogP | 1.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.10 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|