C23H22O4 — CID 54078688
[1-(9H-fluoren-9-yl)-3-hexa-1,3-dienoxy-2-oxopropyl] formate (PubChem CID 54078688) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is [1-(9H-fluoren-9-yl)-3-hexa-1,3-dienoxy-2-oxopropyl] formate.
| Compound Name | [1-(9H-fluoren-9-yl)-3-hexa-1,3-dienoxy-2-oxopropyl] formate |
|---|---|
| PubChem CID | 54078688 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [1-(9H-fluoren-9-yl)-3-hexa-1,3-dienoxy-2-oxopropyl] formate |
| SMILES | CCC=CC=COCC(=O)C(OC=O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H22O4/c1-2-3-4-9-14-26-15-21(25)23(27-16-24)22-19-12-7-5-10-17(19)18-11-6-8-13-20(18)22/h3-14,16,22-23H,2,15H2,1H3 |
| InChIKey | YSIABPSZKXRQGG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|