C9H6Cl2N4 — CID 5407877
(Z)-1-(2,4-dichlorophenyl)-N-(1H-1,2,4-triazol-5-yl)methanimine (PubChem CID 5407877) has the molecular formula C9H6Cl2N4 and a molecular weight of 241.08 g/mol. Its IUPAC name is (Z)-1-(2,4-dichlorophenyl)-N-(1H-1,2,4-triazol-5-yl)methanimine.
| Compound Name | (Z)-1-(2,4-dichlorophenyl)-N-(1H-1,2,4-triazol-5-yl)methanimine |
|---|---|
| PubChem CID | 5407877 |
| Molecular Formula | C9H6Cl2N4 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | (Z)-1-(2,4-dichlorophenyl)-N-(1H-1,2,4-triazol-5-yl)methanimine |
| SMILES | Clc1ccc(/C=N\c2ncn[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2N4/c10-7-2-1-6(8(11)3-7)4-12-9-13-5-14-15-9/h1-5H,(H,13,14,15)/b12-4- |
| InChIKey | IKZFQFDQQNFWNI-QCDXTXTGSA-N |
| XLogP | 2.86 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|