About 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol
8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol (PubChem CID 54079332) has the molecular formula C24H44O
and a molecular weight of 348.62 g/mol. Its IUPAC name is 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol.
Molecular Properties
| Compound Name | 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol |
| PubChem CID | 54079332 |
| Molecular Formula | C24H44O |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.34 |
| IUPAC Name | 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol |
| SMILES | CCCCCCC=C[C@H]1CCC[C@@H]1CC=CCCCC(CO)CCC |
| InChI | InChI=1S/C24H44O/c1-3-5-6-7-8-12-17-23-19-14-20-24(23)18-13-10-9-11-16-22(21-25)15-4-2/h10,12-13,17,22-25H,3-9,11,14-16,18-21H2,1-2H3/t22?,23-,24-/m0/s1 |
| InChIKey | MLYKDHTVJNAYSK-VYCPFJESSA-N |
| XLogP | 7.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol?
The IUPAC name of 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol (CID 54079332) is 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol.
What is the SMILES notation for 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol?
The canonical SMILES for 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol is CCCCCCC=C[C@H]1CCC[C@@H]1CC=CCCCC(CO)CCC.
What is the InChIKey of 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol?
The InChIKey is MLYKDHTVJNAYSK-VYCPFJESSA-N. The full InChI is InChI=1S/C24H44O/c1-3-5-6-7-8-12-17-23-19-14-20-24(23)18-13-10-9-11-16-22(21-25)15-4-2/h10,12-13,17,22-25H,3-9,11,14-16,18-21H2,1-2H3/t22?,23-,24-/m0/s1.
What are the key properties of 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol?
8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol has a molecular weight of 348.62 g/mol, XLogP of 7.45, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-propyloct-6-en-1-ol is sourced from PubChem (CID 54079332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).