C13H20O6 — CID 540795
ethyl 2-(2,2-dimethylspiro[3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7,2'-oxirane]-4-yl)acetate (PubChem CID 540795) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is ethyl 2-(2,2-dimethylspiro[3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7,2'-oxirane]-4-yl)acetate.
| Compound Name | ethyl 2-(2,2-dimethylspiro[3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7,2'-oxirane]-4-yl)acetate |
|---|---|
| PubChem CID | 540795 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | ethyl 2-(2,2-dimethylspiro[3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7,2'-oxirane]-4-yl)acetate |
| SMILES | CCOC(=O)CC1OCC2(CO2)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C13H20O6/c1-4-15-9(14)5-8-10-11(19-12(2,3)18-10)13(6-16-8)7-17-13/h8,10-11H,4-7H2,1-3H3 |
| InChIKey | PHLVIWSGMVCKAC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|