C27H19F2N3 — CID 54079883
4-(3,4-difluorophenyl)-5-trityl-2H-triazole (PubChem CID 54079883) has the molecular formula C27H19F2N3 and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-5-trityl-2H-triazole.
| Compound Name | 4-(3,4-difluorophenyl)-5-trityl-2H-triazole |
|---|---|
| PubChem CID | 54079883 |
| Molecular Formula | C27H19F2N3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 4-(3,4-difluorophenyl)-5-trityl-2H-triazole |
| SMILES | Fc1ccc(-c2n[nH]nc2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1F |
| InChI | InChI=1S/C27H19F2N3/c28-23-17-16-19(18-24(23)29)25-26(31-32-30-25)27(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-18H,(H,30,31,32) |
| InChIKey | MMIOXSASRZEGAS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|