About [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate
[3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate (PubChem CID 54080014) has the molecular formula C31H34Cl2N2O3
and a molecular weight of 553.53 g/mol. Its IUPAC name is [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate.
Molecular Properties
| Compound Name | [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate |
| PubChem CID | 54080014 |
| Molecular Formula | C31H34Cl2N2O3 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate |
| SMILES | CC(=O)NC1(c2ccccc2)CCN(CCC(OC(=O)CCc2ccccc2)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C31H34Cl2N2O3/c1-23(36)34-31(26-10-6-3-7-11-26)17-20-35(21-18-31)19-16-29(25-13-14-27(32)28(33)22-25)38-30(37)15-12-24-8-4-2-5-9-24/h2-11,13-14,22,29H,12,15-21H2,1H3,(H,34,36) |
| InChIKey | MMLBQIPIKRABIG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate?
The IUPAC name of [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate (CID 54080014) is [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate.
What is the SMILES notation for [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate?
The canonical SMILES for [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate is CC(=O)NC1(c2ccccc2)CCN(CCC(OC(=O)CCc2ccccc2)c2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate?
The InChIKey is MMLBQIPIKRABIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H34Cl2N2O3/c1-23(36)34-31(26-10-6-3-7-11-26)17-20-35(21-18-31)19-16-29(25-13-14-27(32)28(33)22-25)38-30(37)15-12-24-8-4-2-5-9-24/h2-11,13-14,22,29H,12,15-21H2,1H3,(H,34,36).
What are the key properties of [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate?
[3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate has a molecular weight of 553.53 g/mol, XLogP of 6.73, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-acetamido-4-phenylpiperidin-1-yl)-1-(3,4-dichlorophenyl)propyl] 3-phenylpropanoate is sourced from PubChem (CID 54080014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).