C30H24O6 — CID 54080093
tris(4-methylphenyl) benzene-1,3,5-tricarboxylate (PubChem CID 54080093) has the molecular formula C30H24O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is tris(4-methylphenyl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(4-methylphenyl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 54080093 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | tris(4-methylphenyl) benzene-1,3,5-tricarboxylate |
| SMILES | Cc1ccc(OC(=O)c2cc(C(=O)Oc3ccc(C)cc3)cc(C(=O)Oc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C30H24O6/c1-19-4-10-25(11-5-19)34-28(31)22-16-23(29(32)35-26-12-6-20(2)7-13-26)18-24(17-22)30(33)36-27-14-8-21(3)9-15-27/h4-18H,1-3H3 |
| InChIKey | MMMGXCNMSSZGEG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|