C16H18N2O9S — CID 54080292
1-[2,5-dihydroxy-1-(1-methoxycarbonylcyclohexyl)pyrrol-3-yl]-2,5-dioxopyrrole-3-sulfonic acid (PubChem CID 54080292) has the molecular formula C16H18N2O9S and a molecular weight of 414.39 g/mol. Its IUPAC name is 1-[2,5-dihydroxy-1-(1-methoxycarbonylcyclohexyl)pyrrol-3-yl]-2,5-dioxopyrrole-3-sulfonic acid.
| Compound Name | 1-[2,5-dihydroxy-1-(1-methoxycarbonylcyclohexyl)pyrrol-3-yl]-2,5-dioxopyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 54080292 |
| Molecular Formula | C16H18N2O9S |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 1-[2,5-dihydroxy-1-(1-methoxycarbonylcyclohexyl)pyrrol-3-yl]-2,5-dioxopyrrole-3-sulfonic acid |
| SMILES | COC(=O)C1(n2c(O)cc(N3C(=O)C=C(S(=O)(=O)O)C3=O)c2O)CCCCC1 |
| InChI | InChI=1S/C16H18N2O9S/c1-27-15(23)16(5-3-2-4-6-16)18-12(20)7-9(13(18)21)17-11(19)8-10(14(17)22)28(24,25)26/h7-8,20-21H,2-6H2,1H3,(H,24,25,26) |
| InChIKey | RBLMRCKECGJZRT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|