About methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate
methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate (PubChem CID 54080299) has the molecular formula C25H40O6
and a molecular weight of 436.59 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate |
| PubChem CID | 54080299 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate |
| SMILES | CCCCCC(=CC=C1CC[C@@H](OC(C)=O)[C@@H]1CCCCCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C25H40O6/c1-5-6-9-12-22(30-19(2)26)17-15-21-16-18-24(31-20(3)27)23(21)13-10-7-8-11-14-25(28)29-4/h15,17,23-24H,5-14,16,18H2,1-4H3/t23-,24-/m1/s1 |
| InChIKey | MMQAFPBOIKEAHH-DNQXCXABSA-N |
| XLogP | 5.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate?
The IUPAC name of methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate (CID 54080299) is methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate?
The canonical SMILES for methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate is CCCCCC(=CC=C1CC[C@@H](OC(C)=O)[C@@H]1CCCCCCC(=O)OC)OC(C)=O.
What is the InChIKey of methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate?
The InChIKey is MMQAFPBOIKEAHH-DNQXCXABSA-N. The full InChI is InChI=1S/C25H40O6/c1-5-6-9-12-22(30-19(2)26)17-15-21-16-18-24(31-20(3)27)23(21)13-10-7-8-11-14-25(28)29-4/h15,17,23-24H,5-14,16,18H2,1-4H3/t23-,24-/m1/s1.
What are the key properties of methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate?
methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate has a molecular weight of 436.59 g/mol, XLogP of 5.80, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxyoct-2-enylidene)cyclopentyl]heptanoate is sourced from PubChem (CID 54080299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).