About (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid
(2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid (PubChem CID 54080559) has the molecular formula C14H24N2O6
and a molecular weight of 316.35 g/mol. Its IUPAC name is (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid |
| PubChem CID | 54080559 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid |
| SMILES | CCC(CCCC(=O)NCC(=O)O)C(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H24N2O6/c1-2-9(11(17)7-6-10(15)14(21)22)4-3-5-12(18)16-8-13(19)20/h9-10H,2-8,15H2,1H3,(H,16,18)(H,19,20)(H,21,22)/t9?,10-/m0/s1 |
| InChIKey | MMUKWIHQEHZLPN-AXDSSHIGSA-N |
| XLogP | 0.14 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid?
The IUPAC name of (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid (CID 54080559) is (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid.
What is the SMILES notation for (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid?
The canonical SMILES for (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid is CCC(CCCC(=O)NCC(=O)O)C(=O)CC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid?
The InChIKey is MMUKWIHQEHZLPN-AXDSSHIGSA-N. The full InChI is InChI=1S/C14H24N2O6/c1-2-9(11(17)7-6-10(15)14(21)22)4-3-5-12(18)16-8-13(19)20/h9-10H,2-8,15H2,1H3,(H,16,18)(H,19,20)(H,21,22)/t9?,10-/m0/s1.
What are the key properties of (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid?
(2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid has a molecular weight of 316.35 g/mol, XLogP of 0.14, 12 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-10-(carboxymethylamino)-6-ethyl-5,10-dioxodecanoic acid is sourced from PubChem (CID 54080559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).