C10H16F6N4O2 — CID 54080584
N-[2-[2-(2-aminoethylamino)ethyl-(2,2,2-trifluoroacetyl)amino]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 54080584) has the molecular formula C10H16F6N4O2 and a molecular weight of 338.25 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethylamino)ethyl-(2,2,2-trifluoroacetyl)amino]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[2-(2-aminoethylamino)ethyl-(2,2,2-trifluoroacetyl)amino]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 54080584 |
| Molecular Formula | C10H16F6N4O2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[2-[2-(2-aminoethylamino)ethyl-(2,2,2-trifluoroacetyl)amino]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | NCCNCCN(CCNC(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H16F6N4O2/c11-9(12,13)7(21)19-4-6-20(5-3-18-2-1-17)8(22)10(14,15)16/h18H,1-6,17H2,(H,19,21) |
| InChIKey | MMUUVBQLUZCMPN-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|