C20H30O3 — CID 540806
(3a,5a-dimethyl-2-oxo-3,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydro-1H-indeno[5,4-e]inden-6-yl) acetate (PubChem CID 540806) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3a,5a-dimethyl-2-oxo-3,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydro-1H-indeno[5,4-e]inden-6-yl) acetate.
| Compound Name | (3a,5a-dimethyl-2-oxo-3,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydro-1H-indeno[5,4-e]inden-6-yl) acetate |
|---|---|
| PubChem CID | 540806 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3a,5a-dimethyl-2-oxo-3,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydro-1H-indeno[5,4-e]inden-6-yl) acetate |
| SMILES | CC(=O)OC1CCC2C3CCC4CC(=O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C20H30O3/c1-12(21)23-18-7-6-16-15-5-4-13-10-14(22)11-20(13,3)17(15)8-9-19(16,18)2/h13,15-18H,4-11H2,1-3H3 |
| InChIKey | KZDDFUXUOIKOLA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |