About (4-phenoxyphenyl) pyrrolidine-1-carboxylate
(4-phenoxyphenyl) pyrrolidine-1-carboxylate (PubChem CID 54080617) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is (4-phenoxyphenyl) pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-phenoxyphenyl) pyrrolidine-1-carboxylate |
| PubChem CID | 54080617 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (4-phenoxyphenyl) pyrrolidine-1-carboxylate |
| SMILES | O=C(Oc1ccc(Oc2ccccc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C17H17NO3/c19-17(18-12-4-5-13-18)21-16-10-8-15(9-11-16)20-14-6-2-1-3-7-14/h1-3,6-11H,4-5,12-13H2 |
| InChIKey | MMVMFOZOTCAOIK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-phenoxyphenyl) pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenoxyphenyl) pyrrolidine-1-carboxylate?
The IUPAC name of (4-phenoxyphenyl) pyrrolidine-1-carboxylate (CID 54080617) is (4-phenoxyphenyl) pyrrolidine-1-carboxylate.
What is the SMILES notation for (4-phenoxyphenyl) pyrrolidine-1-carboxylate?
The canonical SMILES for (4-phenoxyphenyl) pyrrolidine-1-carboxylate is O=C(Oc1ccc(Oc2ccccc2)cc1)N1CCCC1.
What is the InChIKey of (4-phenoxyphenyl) pyrrolidine-1-carboxylate?
The InChIKey is MMVMFOZOTCAOIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c19-17(18-12-4-5-13-18)21-16-10-8-15(9-11-16)20-14-6-2-1-3-7-14/h1-3,6-11H,4-5,12-13H2.
What are the key properties of (4-phenoxyphenyl) pyrrolidine-1-carboxylate?
(4-phenoxyphenyl) pyrrolidine-1-carboxylate has a molecular weight of 283.33 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenoxyphenyl) pyrrolidine-1-carboxylate is sourced from PubChem (CID 54080617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).