C10F20 — CID 54081913
1,1,2,2,3,4,4,5,6-nonafluoro-3-(1,1,2,2,2-pentafluoroethyl)-5,6-bis(trifluoromethyl)cyclohexane (PubChem CID 54081913) has the molecular formula C10F20 and a molecular weight of 500.07 g/mol. Its IUPAC name is 1,1,2,2,3,4,4,5,6-nonafluoro-3-(1,1,2,2,2-pentafluoroethyl)-5,6-bis(trifluoromethyl)cyclohexane.
| Compound Name | 1,1,2,2,3,4,4,5,6-nonafluoro-3-(1,1,2,2,2-pentafluoroethyl)-5,6-bis(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 54081913 |
| Molecular Formula | C10F20 |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | 1,1,2,2,3,4,4,5,6-nonafluoro-3-(1,1,2,2,2-pentafluoroethyl)-5,6-bis(trifluoromethyl)cyclohexane |
| SMILES | FC(F)(F)C(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C10F20/c11-1(8(22,23)24)2(12,9(25,26)27)5(16,17)6(18,19)3(13,4(1,14)15)7(20,21)10(28,29)30 |
| InChIKey | MNSNVRXZINIHOY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|