C44H12 — CID 54082101
1-dodeca-1,3,5,7,9,11-hexaynyl-2-hepta-1,3,5-triynyl-4-penta-1,3-diynyl-5-tetradeca-1,3,5,7,9,11,13-heptaynylcyclohexa-1,4-diene (PubChem CID 54082101) has the molecular formula C44H12 and a molecular weight of 540.58 g/mol. Its IUPAC name is 1-dodeca-1,3,5,7,9,11-hexaynyl-2-hepta-1,3,5-triynyl-4-penta-1,3-diynyl-5-tetradeca-1,3,5,7,9,11,13-heptaynylcyclohexa-1,4-diene.
| Compound Name | 1-dodeca-1,3,5,7,9,11-hexaynyl-2-hepta-1,3,5-triynyl-4-penta-1,3-diynyl-5-tetradeca-1,3,5,7,9,11,13-heptaynylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 54082101 |
| Molecular Formula | C44H12 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 1-dodeca-1,3,5,7,9,11-hexaynyl-2-hepta-1,3,5-triynyl-4-penta-1,3-diynyl-5-tetradeca-1,3,5,7,9,11,13-heptaynylcyclohexa-1,4-diene |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC1=C(C#CC#CC)CC(C#CC#CC#CC)=C(C#CC#CC#CC#CC#CC#C)C1 |
| InChI | InChI=1S/C44H12/c1-5-9-13-16-18-20-22-23-25-27-30-33-37-42-40-44(38-34-29-26-24-21-19-17-14-10-6-2)43(36-32-28-15-11-7-3)39-41(42)35-31-12-8-4/h1-2H,39-40H2,3-4H3 |
| InChIKey | MNVNVOZCKFICIA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|